CymitQuimica logo

CAS 3376-96-3

:

2-ethylpyridine-4-carboxylic acid

Description:
2-Ethylpyridine-4-carboxylic acid, with the CAS number 3376-96-3, is an organic compound that belongs to the class of pyridine carboxylic acids. It features a pyridine ring substituted with an ethyl group at the second position and a carboxylic acid group at the fourth position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties and can exhibit moderate solubility in polar solvents like water, as well as in organic solvents. The presence of the carboxylic acid group contributes to its acidic nature, allowing it to participate in various chemical reactions, including esterification and amidation. 2-Ethylpyridine-4-carboxylic acid is utilized in the synthesis of pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its unique structure allows for potential applications in medicinal chemistry and material science, making it a compound of interest in various research fields.
Formula:C8H9NO2
InChI:InChI=1/C8H9NO2/c1-2-7-5-6(8(10)11)3-4-9-7/h3-5H,2H2,1H3,(H,10,11)
SMILES:CCc1cc(ccn1)C(=O)O
Synonyms:
  • 2-Ethyl-4-pyridinecarboxylic acid
  • 3376-96-3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.