CAS 33763-20-1
:4-Methyl-2-phenylthiazole-5-carboxylic acid
Description:
4-Methyl-2-phenylthiazole-5-carboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential applications. The carboxylic acid functional group (-COOH) enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and syntheses. The presence of the thiazole moiety suggests potential biological activity, as thiazole derivatives are often explored for their pharmacological properties. Additionally, the compound's structure may influence its reactivity, stability, and interactions with other molecules. Its CAS number, 33763-20-1, allows for easy identification in chemical databases and literature. Overall, 4-Methyl-2-phenylthiazole-5-carboxylic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its distinctive structural features and potential utility in various applications.
Formula:C11H8NO2S
InChI:InChI=1/C11H9NO2S/c1-7-9(11(13)14)15-10(12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14)/p-1
SMILES:Cc1c(C(=O)[O-])sc(c2ccccc2)n1
Synonyms:- 4-Methyl-2-phenyl-1,3-thiazole-5-carboxylic acid
- 4-Methyl-2-Phenyl-1,3-Thiazole-5-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methyl-2-phenylthiazole-5-carboxylic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H9NO2SPurity:97%Molecular weight:219.265-Thiazolecarboxylic acid, 4-methyl-2-phenyl-
CAS:Formula:C11H9NO2SPurity:98%Color and Shape:SolidMolecular weight:219.25974-Methyl-2-phenylthiazole-5-carboxylic acid
CAS:4-Methyl-2-phenylthiazole-5-carboxylic acidPurity:95%Molecular weight:219.26g/mol4-Methyl-2-phenyl-thiazole-5-carboxylic acid
CAS:Formula:C11H9NO2SPurity:97%Color and Shape:SolidMolecular weight:219.26



