CAS 3377-87-5: 3-Bromohexane
Description:3-Bromohexane is an organic compound classified as a haloalkane, specifically a bromoalkane, due to the presence of a bromine atom attached to a hexane chain. Its molecular formula is C6H13Br, indicating it consists of six carbon atoms, thirteen hydrogen atoms, and one bromine atom. This compound is characterized by its moderate polarity, which arises from the electronegativity of the bromine atom, making it more soluble in polar solvents compared to non-polar solvents. 3-Bromohexane is typically a colorless to pale yellow liquid at room temperature and has a relatively low boiling point compared to heavier halogenated compounds. It is used in organic synthesis as an alkylating agent and can participate in various chemical reactions, including nucleophilic substitution and elimination reactions. The presence of the bromine atom also makes it a useful intermediate in the preparation of other organic compounds. Safety precautions should be taken when handling 3-bromohexane, as it can be harmful if inhaled or absorbed through the skin.
Formula:C6H13Br
InChI:InChI=1S/C6H13Br/c1-3-5-6(7)4-2/h6H,3-5H2,1-2H3
InChI key:InChIKey=IOZOJWNUKLCDML-UHFFFAOYSA-N
SMILES:BrC(CC)CCC
- Synonyms:
- Hexane, 3-bromo-
- 3-Bromohexane
3-Bromohexane (contains 2-Bromohexane) (stabilized with Copper chip)
Ref: 3B-B1289
| 10g | 380.00 € |
3-Bromohexane
Ref: IN-DA003J4E
| 5g | 259.00 € |
Ref: 54-OR322159
| 1g | 59.00 € | ||
| 5g | 159.00 € | ||
| 25g | 211.00 € | ||
| 100g | 727.00 € | ||
| 250mg | 37.00 € |
3-Bromohexane (contains 2-Bromohexane) (stabilized with Copper chip)
Ref: 3D-DAA37787
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100g | Discontinued | Request information | |
| 100mg | Discontinued | Request information |
