CAS 33775-94-9
:2-Iodothioanisole
Description:
2-Iodothioanisole, with the CAS number 33775-94-9, is an organic compound characterized by the presence of both iodine and a thioether functional group. It features a thioether moiety, where a sulfur atom is bonded to a methyl group and an aromatic ring, specifically a methoxy-substituted benzene. The iodine atom is attached to the second carbon of the aromatic ring, which influences the compound's reactivity and properties. This compound is typically a colorless to pale yellow liquid with a distinct odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 2-Iodothioanisole is often used in organic synthesis, particularly in reactions involving nucleophilic substitutions and as a reagent in various chemical transformations. Its iodine substituent can serve as a leaving group, making it valuable in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H7IS
InChI:InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3
SMILES:CSc1ccccc1I
Synonyms:- 2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene
- 1-Iodo-2-(methylthio)benzene
- 1-Iodo-2-(Methylsulfanyl)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2-Iodophenyl)(methyl)sulfane
CAS:Formula:C7H7ISPurity:95%Color and Shape:LiquidMolecular weight:250.10002-Iodothioanisole
CAS:2-Iodothioanisole is a synthetic compound that is used as an inhibitor of the enzyme cox-2. It has been shown to inhibit the production of prostaglandins, which are involved in inflammation and pain. 2-Iodothioanisole also inhibits chloride channels, which may be related to its anti-inflammatory activity. This molecule was synthesized by coupling two chlorides with a palladium catalyst. The chlorine atoms were introduced into the molecule using a cross-coupling reaction. 2-Iodothioanisole has been shown to inhibit cox-2 by binding to the active site of this enzyme. 2-Iodothioanisole has also been found to have anti-inflammatory properties, mediated by its inhibition of prostaglandin synthesis and chloride channels.
Formula:C7H7ISPurity:Min. 95%Molecular weight:250.1 g/mol



