
CAS 3378-93-6
:Clociguanil
Description:
Clociguanil, with the CAS number 3378-93-6, is a chemical compound that belongs to the class of guanidine derivatives. It is primarily recognized for its antimalarial properties and has been studied for its potential use in treating malaria caused by Plasmodium species. The compound exhibits a mechanism of action similar to that of other antimalarial agents, potentially interfering with the parasite's ability to synthesize nucleic acids or proteins. Clociguanil is characterized by its relatively low solubility in water, which can affect its bioavailability and therapeutic efficacy. Additionally, it may undergo metabolic transformations in the body, leading to the formation of active metabolites that contribute to its pharmacological effects. Safety and toxicity profiles are essential considerations in its use, as with any pharmaceutical compound. Overall, Clociguanil represents a significant interest in medicinal chemistry, particularly in the context of developing effective treatments for malaria.
Formula:C12H15Cl2N5O
InChI:InChI=1S/C12H15Cl2N5O/c1-12(2)18-10(15)17-11(16)19(12)20-6-7-3-4-8(13)9(14)5-7/h3-5H,6H2,1-2H3,(H4,15,16,17,18)
InChI key:InChIKey=XDTNOYLBDDCJSK-UHFFFAOYSA-N
SMILES:O(CC1=CC(Cl)=C(Cl)C=C1)N2C(C)(C)N=C(N)N=C2N
Synonyms:- 1,3,5-Triazine-2,4-diamine, 1-[(3,4-dichlorophenyl)methoxy]-1,6-dihydro-6,6-dimethyl-
- 4,6-Diamino-1,2-dihydro-2,2-dimethyl-1-(3,4-dichlorobenzyloxy)-1,3,5-triazine
- 1-[(3,4-Dichlorophenyl)methoxy]-1,6-dihydro-6,6-dimethyl-1,3,5-triazine-2,4-diamine
- Clociguanil
- s-Triazine, 4,6-diamino-1-[(3,4-dichlorobenzyl)oxy]-1,2-dihydro-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Clociguanil
CAS:Clociguanil has antimalarial activity.Formula:C12H15Cl2N5OColor and Shape:SolidMolecular weight:316.19
