CAS 33784-44-0

1-(4-chloro-2-nitrophenyl)piperidine

Description:

1-(4-Chloro-2-nitrophenyl)piperidine, with the CAS number 33784-44-0, is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a 4-chloro-2-nitrophenyl substituent, indicating the presence of both a chlorine atom and a nitro group on the aromatic ring. The chlorine atom typically contributes to the compound's reactivity and potential for electrophilic substitution, while the nitro group can enhance the compound's polarity and influence its electronic properties. The presence of these functional groups suggests that the compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, its structural characteristics may affect its solubility, stability, and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks or environmental hazards. Overall, 1-(4-chloro-2-nitrophenyl)piperidine is a compound of interest for further research and application in various chemical and pharmaceutical contexts.

Formula: C₁₁H₁₃ClN₂O₂

InChI: InChI=1/C11H13ClN2O2/c12-9-4-5-10(11(8-9)14(15)16)13-6-2-1-3-7-13/h4-5,8H,1-3,6-7H2

SMILES: C1CCN(CC1)c1ccc(cc1N(=O)=O)Cl

Synonyms:

• 1-(4-Chloro-2-nitro-phenyl)-piperidine
• N-[4-Chloro-2-nitrophenyl]piperidine
• Piperidine, 1-(4-Chloro-2-Nitrophenyl)-

1-(4-Chloro-2-nitrophenyl)piperidine

CAS: 33784-44-0

1-(4-Chloro-2-nitrophenyl)piperidine

Purity: ≥95%

Molecular weight: 240.69g/mol

Ref: 54-OR3880