CymitQuimica logo

CAS 337909-10-1

:

4H-Quinolizine-3-carboxylic acid, 1-formyl-4-oxo-, ethyl ester

Description:
4H-Quinolizine-3-carboxylic acid, 1-formyl-4-oxo-, ethyl ester, identified by CAS number 337909-10-1, is a chemical compound characterized by its quinolizine core structure, which is a bicyclic compound containing a nitrogen atom. This substance features a carboxylic acid functional group and an ester moiety, specifically an ethyl ester, which contributes to its solubility and reactivity. The presence of the formyl group indicates that it has an aldehyde functionality, which can participate in various chemical reactions, such as condensation and oxidation. The compound is likely to exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C13H11NO4
InChI:InChI=1S/C13H11NO4/c1-2-18-13(17)10-7-9(8-15)11-5-3-4-6-14(11)12(10)16/h3-8H,2H2,1H3
InChI key:FWIIXJDAGLXBHT-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC(=C2C=CC=CN2C1=O)C=O
Synonyms:
  • ethyl 1-formyl-4-oxo-4H-quinolizine-3-carboxylate
Found 4 products.