CymitQuimica logo

CAS 337920-48-6

:

2-Chloro-6-[4-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenoxy]benzonitrile

Description:
2-Chloro-6-[4-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenoxy]benzonitrile, with the CAS number 337920-48-6, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a phenoxy moiety, and a dimethylamino group. This compound typically exhibits properties associated with aromatic nitriles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitrile functional group. The dimethylamino group may impart basic characteristics, influencing its interaction with acids and bases. Additionally, the presence of the chloro substituent can affect the compound's electronic properties and reactivity, making it of interest in various chemical applications, including medicinal chemistry and material science. Its structural features suggest potential biological activity, which may warrant further investigation in pharmacological studies. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in research and development.
Formula:C18H15ClN2O2
InChI:InChI=1S/C18H15ClN2O2/c1-21(2)11-10-17(22)13-6-8-14(9-7-13)23-18-5-3-4-16(19)15(18)12-20/h3-11H,1-2H3
InChI key:InChIKey=TTWCBSZHMSVJBI-UHFFFAOYSA-N
SMILES:O(C1=C(C#N)C(Cl)=CC=C1)C2=CC=C(C(C=CN(C)C)=O)C=C2
Synonyms:
  • 2-Chloro-6-[4-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenoxy]benzonitrile
  • Benzonitrile, 2-chloro-6-[4-[3-(dimethylamino)-1-oxo-2-propenyl]phenoxy]-
  • Benzonitrile, 2-chloro-6-[4-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.