CAS 33795-37-8

1,10-Phenanthroline-2-carboxaldehyde

Description:

1,10-Phenanthroline-2-carboxaldehyde is an organic compound characterized by its phenanthroline backbone, which consists of three fused aromatic rings. The presence of a carboxaldehyde functional group (-CHO) at the 2-position of the phenanthroline structure imparts specific reactivity and properties to the molecule. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). It is known for its ability to form chelates with metal ions, making it useful in coordination chemistry and analytical applications. Additionally, 1,10-phenanthroline derivatives are often employed in biological studies due to their potential as fluorescent probes and their role in various biochemical assays. The compound's reactivity can be influenced by the presence of substituents on the phenanthroline rings, which can affect its electronic properties and interactions with other molecules. Overall, 1,10-Phenanthroline-2-carboxaldehyde is a versatile compound with applications in both research and industrial settings.

Formula: C₁₃H₈N₂O

InChI: InChI=1S/C13H8N2O/c16-8-11-6-5-10-4-3-9-2-1-7-14-12(9)13(10)15-11/h1-8H

SMILES: c1cc2ccc3ccc(C=O)nc3c2nc1

Synonyms:

• 1,10-Phenanthroline-2-carbaldehyde
• 2-Formyl-1,10-phenanthroline

1,10-Phenanthroline-2-carboxaldehyde

CAS: 33795-37-8

Formula: C₁₃H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.2154

Ref: IN-DA0038TN

1,10-Phenanthroline-2-Carbaldehyde

CAS: 33795-37-8

1,10-Phenanthroline-2-Carbaldehyde

Purity: 95%

Molecular weight: 208.22g/mol

Ref: 54-OR1025752

1,10-Phenanthroline-2-carbaldehyde

CAS: 33795-37-8

1,10-Phenanthroline-2-carbaldehyde is a phenylhydrazone compound that has been shown to have anticancer activity. It is also a supramolecular complex, which means it can form hydrogen bonds and coordinate bonds with other molecules. The anticancer activity of 1,10-phenanthroline-2-carbaldehyde may be due to its ability to inhibit the growth of prostate carcinoma cells. This compound also inhibits the growth of human cervical carcinoma cells by binding to their DNA and inhibiting the synthesis of RNA and protein. 1,10-Phenanthroline-2-carbaldehyde is being studied for its potential as an inhibitor of tumor angiogenesis.
1,10-Phenanthroline-2-carbaldehyde has been shown to have antiplatelet aggregation effects in platelets from healthy humans as well as those with type 2 diabetes mellitus or chronic kidney disease.

Formula: C₁₃H₈N₂O

Purity: Min. 90 Area-%

Color and Shape: Off-White Powder

Molecular weight: 208.22 g/mol

Ref: 3D-FP34912