CAS 33795-85-6

4,5,6,7-tetrafluoro-2-methyl-1H-isoindole-1,3(2H)-dione

Description:

4,5,6,7-Tetrafluoro-2-methyl-1H-isoindole-1,3(2H)-dione, with the CAS number 33795-85-6, is a synthetic organic compound characterized by its unique structure, which includes a fused isoindole ring system and multiple fluorine substituents. The presence of four fluorine atoms significantly influences its chemical properties, enhancing its stability and lipophilicity while potentially altering its reactivity compared to non-fluorinated analogs. This compound typically exhibits a solid-state at room temperature and may have a relatively high melting point due to the strong intermolecular forces associated with the fluorine atoms. Its functional groups suggest potential applications in pharmaceuticals, agrochemicals, or materials science, particularly in the development of fluorinated compounds that can exhibit unique biological or physical properties. Additionally, the presence of the methyl group contributes to its steric properties, which can affect its interaction with biological targets or other chemical species. Overall, this compound represents a class of fluorinated heterocycles that are of interest in various fields of research.

Formula: C₉H₃F₄NO₂

InChI: InChI=1/C9H3F4NO2/c1-14-8(15)2-3(9(14)16)5(11)7(13)6(12)4(2)10/h1H3

SMILES: CN1C(=O)c2c(c(c(c(c2F)F)F)F)C1=O

N-Methyltetrafluorophthalimide

CAS: 33795-85-6

Formula: C₉H₃F₄NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 233.1192

Ref: IN-DA003T8M

N-Methyl-3,4,5,6-tetrafluorophthalimide

CAS: 33795-85-6

N-Methyl-3,4,5,6-tetrafluorophthalimide

Purity: 97%

Color and Shape: White Powder

Molecular weight: 233.12g/mol

Ref: 54-PC6543

3,4,5,6-Tetrafluoro-N-methylphthalimide

CAS: 33795-85-6

3,4,5,6-Tetrafluoro-N-methylphthalimide is a metal halide that is used in the preparation of oxetane derivatives. It is synthesized from the reaction of phthalimides with styrene and 3,4,5,6-tetrafluoro-N-methylbenzoic acid. The reaction time can be varied to produce different products. The acylation reaction occurs by heating the mixture at high temperature and pressure. 3,4,5,6-Tetrafluoro-N-methylphthalimide has been shown to react with pyrrole to form 2,4,5-trifluorobenzoic acid chloride.

Formula: C₉H₃F₄NO₂

Purity: Min. 95%

Molecular weight: 233.12 g/mol

Ref: 3D-FT75355

4,5,6,7-Tetrafluoro-2-methylisoindoline-1,3-dione

CAS: 33795-85-6

Purity: 98%

Molecular weight: 233.12

Ref: 10-F634300

N-Methyltetrafluorophthalimide

CAS: 33795-85-6

Formula: C₉H₃F₄NO₂

Molecular weight: 233.12

Ref: ST-EA-CP-M26041