CAS 337953-81-8

4-Bromo-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzeneacetic acid

Description:

4-Bromo-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzeneacetic acid is a chemical compound characterized by its complex structure, which includes a bromine atom, a fluorenylmethoxycarbonyl (Fmoc) protecting group, and an amino acid moiety. This compound is typically used in peptide synthesis and bioconjugation due to the presence of the Fmoc group, which allows for selective protection of amino groups during chemical reactions. The bromine substituent enhances the compound's reactivity and can facilitate further functionalization. The benzeneacetic acid component contributes to its acidic properties, making it relevant in various biochemical applications. Additionally, the compound's molecular structure suggests potential interactions with biological systems, which may be explored in drug development or as a research tool in biochemistry. Its solubility and stability in different solvents can vary, influencing its application in laboratory settings. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, showcasing the utility of functionalized amino acids in synthetic methodologies.

Formula: C₂₃H₁₈BrNO₄

InChI: InChI=1S/C23H18BrNO4/c24-15-11-9-14(10-12-15)21(22(26)27)25-23(28)29-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13H2,(H,25,28)(H,26,27)

InChI key: InChIKey=YZEMVMPFMBPCHY-UHFFFAOYSA-N

SMILES: C(OC(NC(C(O)=O)C1=CC=C(Br)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 2-(4-Bromophenyl)-2-([[(9H-fluoren-9-yl)methoxy]carbonyl]amino)acetic acid
• 4-Bromo-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzeneacetic acid
• Benzeneacetic acid, 4-bromo-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-

2-(4-Bromophenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid

CAS: 337953-81-8

Versatile small molecule scaffold

Formula: C₂₃H₁₈BrNO₄

Purity: Min. 95%

Molecular weight: 452.3 g/mol

Ref: 3D-MNA95381