CAS 337958-60-8

5,7-Dichloro-1,6-naphthyridine

Description:

5,7-Dichloro-1,6-naphthyridine is a heterocyclic organic compound characterized by a fused bicyclic structure containing nitrogen atoms in its ring system. It features two chlorine substituents at the 5 and 7 positions of the naphthyridine framework, which can influence its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its ability to interact with biological targets. The presence of chlorine atoms can enhance lipophilicity and alter the electronic properties of the molecule, making it a subject of interest in drug design. Additionally, 5,7-Dichloro-1,6-naphthyridine may exhibit specific pharmacological activities, which can be explored through further research. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₈H₄Cl₂N₂

InChI: InChI=1/C8H4Cl2N2/c9-7-4-6-5(8(10)12-7)2-1-3-11-6/h1-4H

SMILES: c1cc2c(cc(Cl)nc2Cl)nc1

5,7-Dichloro-1,6-naphthyridine

CAS: 337958-60-8

Formula: C₈H₄Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.0368

Ref: IN-DA007IST

5,7-Dichloro-1,6-naphthyridine

CAS: 337958-60-8

5,7-Dichloro-1,6-naphthyridine

Purity: 98%

Molecular weight: 199.04g/mol

Ref: 54-OR951540

5,7-Dichloro-1,6-naphthyridine

CAS: 337958-60-8

Formula: C₈H₄Cl₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.03

Ref: 10-F093653