CymitQuimica logo

CAS 33797-34-1

:

(3-Methoxy-2-methylphenyl)methanol

Description:
(3-Methoxy-2-methylphenyl)methanol, with the CAS number 33797-34-1, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a hydroxymethyl group attached to a methyl-substituted phenyl ring. This compound typically exhibits properties associated with phenolic compounds, such as moderate solubility in organic solvents and potential hydrogen bonding due to the presence of the hydroxymethyl group. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. The methoxy group can influence the compound's reactivity and polarity, affecting its interactions in biological systems and its potential applications in pharmaceuticals or as a chemical intermediate. Additionally, the presence of both methoxy and hydroxymethyl functionalities may impart unique physical properties, such as melting and boiling points, which are influenced by intermolecular forces. Overall, (3-Methoxy-2-methylphenyl)methanol is a compound of interest in organic chemistry, particularly in the study of aromatic compounds and their derivatives.
Formula:C9H12O2
InChI:InChI=1S/C9H12O2/c1-7-8(6-10)4-3-5-9(7)11-2/h3-5,10H,6H2,1-2H3
InChI key:CRKISCPFEDTNCG-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1OC)CO
Synonyms:
  • 3-Methoxy-2-methylbenzyl alcohol
  • Benzenemethanol, 3-methoxy-2-methyl-
Found 4 products.