CAS 337972-47-1

2-[4-(4-Chlorophenyl)piperazin-1-ylmethyl]pyrazolo[1,5-a]pyridine

Description:

2-[4-(4-Chlorophenyl)piperazin-1-ylmethyl]pyrazolo[1,5-a]pyridine is a chemical compound characterized by its complex structure, which includes a pyrazolo[1,5-a]pyridine core fused with a piperazine moiety. This compound features a chlorophenyl group, which contributes to its potential biological activity. The presence of the piperazine ring suggests that it may interact with various neurotransmitter systems, making it of interest in pharmacological research, particularly in the context of neuropsychiatric disorders. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and bioavailability. Additionally, the chlorine substituent may enhance lipophilicity and modulate the compound's pharmacokinetic properties. Overall, this compound's unique structural features position it as a candidate for further investigation in medicinal chemistry and drug development, particularly in the search for novel therapeutic agents.

Formula: C₁₈H₁₉ClN₄

InChI: InChI=1/C18H19ClN4/c19-15-4-6-17(7-5-15)22-11-9-21(10-12-22)14-16-13-18-3-1-2-8-23(18)20-16/h1-8,13H,9-12,14H2

SMILES: c1ccn2c(c1)cc(CN1CCN(CC1)c1ccc(cc1)Cl)n2

Synonyms:

• Fauc-213
• 2-{[4-(4-Chlorophenyl)Piperazin-1-Yl]Methyl}Pyrazolo[1,5-A]Pyridine

FAUC 213

CAS: 337972-47-1

Formula: C₁₈H₁₉ClN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 326.8233

Ref: IN-DA007ISR

FAUC 213

CAS: 337972-47-1

FAUC 213

Purity: 98%

Molecular weight: 326.82g/mol

Ref: 54-OR1023276

FAUC 213

CAS: 337972-47-1

FAUC 213

Purity: ≥98%

Molecular weight: 326.82g/mol

Ref: 54-BUP02103

FAUC 213

CAS: 337972-47-1

Formula: C₁₈H₁₉ClN₄

Molecular weight: 326.82

Ref: 7W-GL2294

FAUC 213

CAS: 337972-47-1

FAUC 213 is a selective full antagonist of the dopamine D4 receptor.

Formula: C₁₈H₁₉ClN₄

Purity: 99.84%

Color and Shape: Solid

Molecular weight: 326.82

Ref: TM-T24055