CAS 338-03-4
:4,4,4-trifluoro-3-hydroxy-3-methylbutyric acid
Description:
4,4,4-Trifluoro-3-hydroxy-3-methylbutyric acid, with the CAS number 338-03-4, is an organic compound characterized by the presence of three fluorine atoms, a hydroxyl group, and a branched alkyl chain. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical applications. The hydroxyl group provides potential for hydrogen bonding, affecting its solubility and interaction with other molecules. The presence of the methyl group adds steric hindrance, which can impact the compound's conformation and reactivity. Overall, 4,4,4-trifluoro-3-hydroxy-3-methylbutyric acid is notable for its unique combination of functional groups and fluorinated structure, which can lead to distinctive chemical properties and potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C5H6F3O3
InChI:InChI=1/C5H7F3O3/c1-4(11,2-3(9)10)5(6,7)8/h11H,2H2,1H3,(H,9,10)/p-1/t4-/m1/s1
SMILES:C[C@@](CC(=O)[O-])(C(F)(F)F)O
Synonyms:- 3-Hydroxy-3-methyl-4,4,4-trifluorobutyric acid
- 3-Hydroxy-4,4,4-trifluoroisovaleric acid~4,4,4-Trifluoro-3-hydroxy-3-methylbutyric acid~3-Trifluoromethyl-3-hydroxybutyric acid
- 4,4,4-Trifluoro-3-Hydroxy-3-Methylbutanoic Acid
- (3S)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoate
- (3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,4,4-Trifluoro-3-hydroxy-3-methylbutyric acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H6F3O3Purity:98%Color and Shape:White or clear colorless to pale yellow, Fused solid or liquid as meltMolecular weight:171.104,4,4-Trifluoro-3-hydroxy-3-methylbutanoic acid
CAS:Formula:C5H7F3O3Purity:95%Color and Shape:SolidMolecular weight:172.10253-Hydroxy-3-(trifluoromethyl)butyric acid
CAS:<p>3-Hydroxy-3-(trifluoromethyl)butyric acid</p>Purity:95%Color and Shape:White SolidMolecular weight:172.10g/mol3-(Trifluoromethyl)-3-hydroxybutyric acid
CAS:Formula:C5H7F3O3Purity:95%Color and Shape:Liquid, ClearMolecular weight:172.103



