CAS 338-70-5
:Oxalate(2-)
Description:
Oxalate(2-) refers to the oxalate ion, which is a dianion derived from oxalic acid. It has the chemical formula C2O4^2- and is characterized by its two negative charges, resulting from the deprotonation of both carboxylic acid groups in oxalic acid. The oxalate ion is a planar molecule, exhibiting a symmetrical structure with two carbon atoms bonded to four oxygen atoms, two of which are double-bonded to the carbons, while the other two carry negative charges. This ion is commonly found in various salts, such as calcium oxalate, and is known for its role in biological systems, particularly in plants and certain metabolic processes. Oxalate can form complexes with metal ions, influencing their solubility and bioavailability. It is also recognized for its potential to form insoluble precipitates, which can be relevant in both environmental chemistry and human health, particularly in the formation of kidney stones. The CAS number 338-70-5 specifically identifies the oxalate ion in chemical databases, facilitating its study and application in various fields.
Formula:C2O4
InChI:InChI=1S/C2H2O4/c3-1(4)2(5)6/h(H,3,4)(H,5,6)/p-2
InChI key:InChIKey=MUBZPKHOEPUJKR-UHFFFAOYSA-L
SMILES:C(C([O-])=O)([O-])=O
Synonyms:- Oxalate ion(2-)
- Oxalate dianion
- Oxalate ion (C2O42-)
- Oxalate ion(2-)
- Oxalate ion (C2O42-)
- Oxalicacid, ion(2-) (8CI)
- Ethanedioic acid, ion(2-)
- Oxalate(2-)
- Oxalate(2-)
- Oxalate (C2O42-)
- Oxalic acid, ion(2-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.