CymitQuimica logo

CAS 3383-66-2

:

(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoate

Description:
(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoate, with the CAS number 3383-66-2, is a chemical compound characterized by its unique structural features, including a propanoate group and a benzothiazole moiety. This compound typically exhibits properties associated with both the ester functional group and the presence of a sulfur atom in the benzothiazole ring, which can influence its reactivity and solubility. The stereochemistry indicated by the (2R) designation suggests that it has a specific spatial arrangement, which can affect its biological activity and interactions with other molecules. Compounds of this nature may be of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anti-inflammatory activities. Additionally, the presence of the benzothiazole ring often contributes to the compound's ability to interact with biological targets, making it a subject of research in various fields, including drug development and materials science. Overall, the characteristics of this compound make it a valuable entity for further study in chemical and pharmaceutical applications.
Formula:C10H8NO2S2
InChI:InChI=1/C10H9NO2S2/c1-6(9(12)13)14-10-11-7-4-2-3-5-8(7)15-10/h2-6H,1H3,(H,12,13)/p-1/t6-/m1/s1
SMILES:C[C@H](C(=O)[O-])Sc1nc2ccccc2s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 2-(1,3-Benzothiazol-2-ylthio)propanoic Acid

    Controlled Product
    CAS:
    Formula:C10H9NO2S2
    Color and Shape:Neat
    Molecular weight:239.314

    Ref: TR-B412428

    1g
    1,530.00€