CAS 338393-43-4

Methyl 2-[(2-chloro-5-thiazolyl)methoxy]benzoate

Description:

Methyl 2-[(2-chloro-5-thiazolyl)methoxy]benzoate, identified by its CAS number 338393-43-4, is a chemical compound characterized by its thiazole and benzoate functional groups. This substance typically appears as a solid or liquid, depending on its specific formulation and purity. It features a methyl ester group, which contributes to its solubility in organic solvents. The presence of the thiazole ring, a five-membered heterocyclic compound containing sulfur and nitrogen, imparts unique biological properties, making it of interest in pharmaceutical research. The chlorine atom in the thiazole moiety can influence the compound's reactivity and biological activity. Methyl 2-[(2-chloro-5-thiazolyl)methoxy]benzoate may exhibit various properties such as antimicrobial or antifungal activity, which are common in compounds containing thiazole derivatives. Its synthesis typically involves the reaction of appropriate benzoic acid derivatives with thiazole-containing reagents, and it may be utilized in various applications, including agrochemicals and medicinal chemistry. Safety and handling precautions should be observed due to its potential biological activity.

Formula: C₁₂H₁₀ClNO₃S

InChI: InChI=1S/C12H10ClNO3S/c1-16-11(15)9-4-2-3-5-10(9)17-7-8-6-14-12(13)18-8/h2-6H,7H2,1H3

InChI key: InChIKey=OOPMTXOMEHHFKS-UHFFFAOYSA-N

SMILES: O(CC1=CN=C(Cl)S1)C2=C(C(OC)=O)C=CC=C2

Synonyms:

• Benzoic acid, 2-[(2-chloro-5-thiazolyl)methoxy]-, methyl ester
• Methyl 2-[(2-chloro-5-thiazolyl)methoxy]benzoate