CAS 3384-24-5: 9-Hydroxyoctadecanoic acid

Description:9-Hydroxyoctadecanoic acid, also known as ricinoleic acid, is a monounsaturated fatty acid characterized by its long carbon chain and a hydroxyl group at the ninth carbon position. This compound is derived from castor oil and is notable for its unique properties, including its ability to act as a surfactant and emulsifier due to the presence of the hydroxyl group. It has a hydrophobic tail, which allows it to interact with lipids, while the hydroxyl group provides hydrophilic characteristics. This dual nature makes ricinoleic acid useful in various applications, including cosmetics, pharmaceuticals, and food products. Additionally, it exhibits anti-inflammatory and analgesic properties, contributing to its use in topical formulations. The compound is typically a colorless to pale yellow liquid or solid at room temperature and has a characteristic odor. Its chemical structure contributes to its reactivity, making it a valuable intermediate in organic synthesis and the production of various derivatives.

Formula:C₁₈H₃₆O₃

InChI:InChI=1S/C18H36O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21)

InChI key:InChIKey=RKHXDCVAPIMDMG-UHFFFAOYSA-N

SMILES:O=C(O)CCCCCCCC(O)CCCCCCCCC

Synonyms:
9-Hydroxystearic acid
9R-hydroxy-octadecanoic acid
Octadecanoic Acid, 9-Hydroxy-
Octadecanoic acid, 9-hydroxy-, D-(-)-
9-Hydroxyoctadecanoic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
9-hydroxy Stearic Acid REF: 54-BUP00728CAS: 3384-24-5	99.7%	697.00 €~1,270.00 €	Tue 15 Apr 25
9-hydroxy Stearic Acid REF: TM-T37067CAS: 3384-24-5	99.7%	47.00 €~938.00 €	Tue 15 Apr 25
9(R)-Hydroxyoctadecanoic acid REF: 48-14-1809CAS: 3384-24-5	>98%	To inquire	Mon 14 Apr 25
9-Hydroxy Stearic Acid REF: 4Z-S-057008CAS: 3384-24-5	- - -	To inquire	Mon 21 Apr 25
9(R)-Hydroxyoctadecanoic acid REF: 3D-DAA38424CAS: 3384-24-5	Min. 95%	- - -	Discontinued product