CAS 338404-89-0

Methyl 3-(benzoylamino)-6-methyl-2-oxo-2H-pyran-5-carboxylate

Description:

Methyl 3-(benzoylamino)-6-methyl-2-oxo-2H-pyran-5-carboxylate, identified by its CAS number 338404-89-0, is a synthetic organic compound characterized by its complex structure, which includes a pyran ring, a carboxylate group, and a benzoylamino substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of the methyl and benzoyl groups suggests that it may have moderate lipophilicity, making it suitable for various applications in organic synthesis and medicinal chemistry. The pyran ring structure indicates potential for tautomerism and reactivity in electrophilic substitution reactions. Additionally, the compound may exhibit biological activity, which could be explored in pharmacological studies. Overall, its unique structural features and functional groups make it a compound of interest in the fields of organic chemistry and drug development.

Formula: C₁₅H₁₃NO₅

InChI: InChI=1S/C15H13NO5/c1-9-11(14(18)20-2)8-12(15(19)21-9)16-13(17)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,16,17)

InChI key: InChIKey=LAQUSGABDKJNSQ-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CC=C1)C2=CC(C(OC)=O)=C(C)OC2=O

Synonyms:

• 2H-Pyran-5-carboxylic acid, 3-(benzoylamino)-6-methyl-2-oxo-, methyl ester
• Methyl 3-(benzoylamino)-6-methyl-2-oxo-2H-pyran-5-carboxylate