CAS 338412-34-3

4-Chloro-α-[[[(4-methoxyphenyl)methyl]sulfonyl]methyl]-α-methylbenzenemethanol

Description:

4-Chloro-α-[[[(4-methoxyphenyl)methyl]sulfonyl]methyl]-α-methylbenzenemethanol, identified by CAS number 338412-34-3, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a methoxyphenyl moiety, and a sulfonyl functional group. This compound typically exhibits properties associated with sulfonyl-containing compounds, such as increased solubility in polar solvents and potential biological activity due to its structural features. The presence of the chloro substituent may enhance its reactivity and influence its interaction with biological targets. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance, potentially impacting its pharmacological profile. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications.

Formula: C₁₇H₁₉ClO₄S

InChI: InChI=1S/C17H19ClO4S/c1-17(19,14-5-7-15(18)8-6-14)12-23(20,21)11-13-3-9-16(22-2)10-4-13/h3-10,19H,11-12H2,1-2H3

InChI key: InChIKey=MQOSYSKVAGRKLG-UHFFFAOYSA-N

SMILES: C(S(CC(C)(O)C1=CC=C(Cl)C=C1)(=O)=O)C2=CC=C(OC)C=C2

Synonyms:

• Benzenemethanol, 4-chloro-α-[[[(4-methoxyphenyl)methyl]sulfonyl]methyl]-α-methyl-
• 4-Chloro-α-[[[(4-methoxyphenyl)methyl]sulfonyl]methyl]-α-methylbenzenemethanol