
CAS 338419-52-6
:N-[2-[(2-Hydroxyethyl)amino]-2-oxoethyl]-3-methylbenzamide
Description:
N-[2-[(2-Hydroxyethyl)amino]-2-oxoethyl]-3-methylbenzamide, identified by its CAS number 338419-52-6, is a chemical compound that features a complex structure characterized by the presence of an amide functional group, a hydroxyl group, and a methyl-substituted aromatic ring. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in polar solvents due to the hydroxyl and amino groups, which can engage in hydrogen bonding. The presence of the 3-methylbenzamide moiety suggests potential applications in pharmaceuticals or biochemistry, as modifications to aromatic amides can influence biological activity. Additionally, the compound's structure indicates it may participate in various chemical reactions, including acylation and amination, making it of interest in synthetic organic chemistry. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C12H16N2O3
InChI:InChI=1S/C12H16N2O3/c1-9-3-2-4-10(7-9)12(17)14-8-11(16)13-5-6-15/h2-4,7,15H,5-6,8H2,1H3,(H,13,16)(H,14,17)
InChI key:InChIKey=NCPXTDOSHQTQIG-UHFFFAOYSA-N
SMILES:C(NCC(NCCO)=O)(=O)C1=CC(C)=CC=C1
Synonyms:- Benzamide, N-[2-[(2-hydroxyethyl)amino]-2-oxoethyl]-3-methyl-
- N-[2-[(2-Hydroxyethyl)amino]-2-oxoethyl]-3-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.