CAS 338419-53-7

4-Fluoro-N-[2-[(2-hydroxyethyl)amino]-2-oxoethyl]benzamide

Description:

4-Fluoro-N-[2-[(2-hydroxyethyl)amino]-2-oxoethyl]benzamide is a chemical compound characterized by its specific functional groups and structural features. It contains a benzamide moiety, which is a derivative of benzoic acid where an amide group is attached to the benzene ring. The presence of a fluorine atom at the para position of the benzene ring enhances its biological activity and lipophilicity. The compound also features a hydroxyethyl group linked to an amino group, contributing to its solubility and potential interactions in biological systems. This structure suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a pharmaceutical agent. The compound's molecular interactions could be influenced by hydrogen bonding due to the hydroxyl and amine groups, making it a candidate for various applications in drug development. Its CAS number, 338419-53-7, allows for easy identification and reference in chemical databases. Overall, the unique combination of functional groups in this compound may lead to interesting pharmacological properties.

Formula: C₁₁H₁₃FN₂O₃

InChI: InChI=1S/C11H13FN2O3/c12-9-3-1-8(2-4-9)11(17)14-7-10(16)13-5-6-15/h1-4,15H,5-7H2,(H,13,16)(H,14,17)

InChI key: InChIKey=GWRSLYBGSXCIOB-UHFFFAOYSA-N

SMILES: C(NCC(NCCO)=O)(=O)C1=CC=C(F)C=C1

Synonyms:

• 4-Fluoro-N-[2-[(2-hydroxyethyl)amino]-2-oxoethyl]benzamide
• Benzamide, 4-fluoro-N-[2-[(2-hydroxyethyl)amino]-2-oxoethyl]-

(4-Fluorobenzamido)-N-(2-hydroxyethyl)acetamide

CAS: 338419-53-7

(4-Fluorobenzamido)-N-(2-hydroxyethyl)acetamide

Purity: 97%

Molecular weight: 240.23g/mol

Ref: 54-PC9340