CymitQuimica logo

CAS 338419-73-1

:

3-Pyridinylmethyl 8-methoxy-2H-1-benzopyran-3-carboxylate

Description:
3-Pyridinylmethyl 8-methoxy-2H-1-benzopyran-3-carboxylate, identified by its CAS number 338419-73-1, is a chemical compound that belongs to the class of benzopyran derivatives. This substance features a pyridine ring, which contributes to its potential biological activity, and a benzopyran structure that is known for its diverse pharmacological properties. The presence of a methoxy group enhances its lipophilicity, potentially influencing its solubility and bioavailability. The carboxylate functional group may play a role in its reactivity and interactions with biological targets. Compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in various chemical environments. Overall, this compound exemplifies the complexity and potential utility of heterocyclic organic molecules in drug discovery and development.
Formula:C17H15NO4
InChI:InChI=1S/C17H15NO4/c1-20-15-6-2-5-13-8-14(11-21-16(13)15)17(19)22-10-12-4-3-7-18-9-12/h2-9H,10-11H2,1H3
InChI key:InChIKey=AIQDNQUDZNMYIR-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C=C(C(OCC=3C=CC=NC3)=O)CO2)=CC=C1
Synonyms:
  • 2H-1-Benzopyran-3-carboxylic acid, 8-methoxy-, 3-pyridinylmethyl ester
  • 3-Pyridinylmethyl 8-methoxy-2H-1-benzopyran-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.