CymitQuimica logo

CAS 338420-99-8

:

[3-Chloro-5-(trifluoromethyl)-2-pyridinyl](3-methoxyphenyl)methanone

Description:
The chemical substance known as [3-Chloro-5-(trifluoromethyl)-2-pyridinyl](3-methoxyphenyl)methanone, with the CAS number 338420-99-8, is a synthetic organic compound that features a complex structure incorporating both a pyridine and a methoxyphenyl moiety. It is characterized by the presence of a chloro group and a trifluoromethyl group, which contribute to its unique chemical reactivity and physical properties. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, while the chloro substituent can influence the compound's electronic properties and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental conditions such as pH and temperature. Proper handling and safety measures are essential due to the presence of halogenated groups, which can pose health and environmental risks.
Formula:C14H9ClF3NO2
InChI:InChI=1S/C14H9ClF3NO2/c1-21-10-4-2-3-8(5-10)13(20)12-11(15)6-9(7-19-12)14(16,17)18/h2-7H,1H3
InChI key:InChIKey=DKERSMNRMLLQMN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(C(F)(F)F)C=N1)C2=CC(OC)=CC=C2
Synonyms:
  • Methanone, [3-chloro-5-(trifluoromethyl)-2-pyridinyl](3-methoxyphenyl)-
  • [3-Chloro-5-(trifluoromethyl)-2-pyridinyl](3-methoxyphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.