CAS 338421-54-8

N-[(4-Fluorophenyl)sulfonyl]glycine hydrazide

Description:

N-[(4-Fluorophenyl)sulfonyl]glycine hydrazide is a chemical compound characterized by its unique structure, which includes a sulfonyl group attached to a glycine hydrazide moiety. This compound features a 4-fluorophenyl group, contributing to its potential biological activity and reactivity. The sulfonyl group enhances the compound's solubility and stability, while the hydrazide functional group may impart specific reactivity, particularly in the context of forming hydrazones or participating in condensation reactions. The presence of the fluorine atom can influence the compound's electronic properties, potentially affecting its interaction with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to various pharmacological activities. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from research in biochemical pathways to potential therapeutic uses. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₈H₁₀FN₃O₃S

InChI: InChI=1S/C8H10FN3O3S/c9-6-1-3-7(4-2-6)16(14,15)11-5-8(13)12-10/h1-4,11H,5,10H2,(H,12,13)

InChI key: InChIKey=QDBYMTZZJCKJPE-UHFFFAOYSA-N

SMILES: S(NCC(NN)=O)(=O)(=O)C1=CC=C(F)C=C1

Synonyms:

• Glycine, N-[(4-fluorophenyl)sulfonyl]-, hydrazide
• N-[(4-Fluorophenyl)sulfonyl]glycine hydrazide