CAS 338454-02-7

methyl 3,5-dihydroxy-4-iodo-benzoate

Description:

Methyl 3,5-dihydroxy-4-iodo-benzoate, identified by its CAS number 338454-02-7, is an organic compound that belongs to the class of benzoate esters. This substance features a benzoic acid derivative with hydroxyl groups at the 3 and 5 positions and an iodine atom at the 4 position of the aromatic ring. The presence of these functional groups contributes to its chemical reactivity and potential biological activity. The hydroxyl groups can participate in hydrogen bonding, influencing the compound's solubility and interaction with other molecules. As an ester, it may undergo hydrolysis in the presence of water, leading to the release of the corresponding alcohol and acid. The iodine substituent can impart unique properties, such as increased lipophilicity and potential applications in medicinal chemistry. Overall, methyl 3,5-dihydroxy-4-iodo-benzoate is of interest in various fields, including pharmaceuticals and agrochemicals, due to its structural characteristics and potential biological effects.

Formula: C₈H₇IO₄

InChI: InChI=1/C8H7IO4/c1-13-8(12)4-2-5(10)7(9)6(11)3-4/h2-3,10-11H,1H3

SMILES: COC(=O)c1cc(c(c(c1)O)I)O

Methyl 3,5-dihydroxy-4-iodobenzoate

CAS: 338454-02-7

Formula: C₈H₇IO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 294.0433

Ref: IN-DA00CL1R

Methyl 3,5-dihydroxy-4-iodobenzoate

CAS: 338454-02-7

Methyl 3,5-dihydroxy-4-iodobenzoate

Purity: 97%

Molecular weight: 294.04g/mol

Ref: 54-OR93709

Methyl 3,5-dihydroxy-4-iodobenzoate

CAS: 338454-02-7

Formula: C₈H₇IO₄

Purity: 97%

Molecular weight: 294.044

Ref: 10-F339794