CAS 338454-14-1
:1H-indazol-5-ylboronic acid
Description:
1H-Indazol-5-ylboronic acid is an organic compound characterized by the presence of both an indazole ring and a boronic acid functional group. The indazole moiety contributes to its aromaticity and potential for various chemical reactions, while the boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. This compound typically exhibits good solubility in polar solvents, which enhances its reactivity in coupling reactions, such as Suzuki-Miyaura cross-coupling, a widely used method for forming carbon-carbon bonds. Additionally, the presence of the boronic acid group allows for potential applications in drug development, particularly in the design of inhibitors targeting specific biological pathways. The compound's molecular structure and properties make it a valuable building block in organic synthesis and a subject of interest in research focused on developing new therapeutic agents.
Formula:C7H7BN2O2
InChI:InChI=1/C7H7BN2O2/c11-8(12)6-1-2-7-5(3-6)4-9-10-7/h1-4,11-12H,(H,9,10)
SMILES:c1cc2c(cc1B(O)O)cn[nH]2
Synonyms:- Boronic acid, B-1H-indazol-5-yl-
- 1H-Indazole-5-boronicacid
- 1H-Indazole-5-Boronic Acid
- (1H-indazol-5-yl)boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Indazole-5-boronic acid
CAS:Formula:C7H7BN2O2Purity:97%Color and Shape:SolidMolecular weight:161.95371H-Indazole-5-boronic acid
CAS:1H-Indazole-5-boronic acidFormula:C7H7BN2O2Purity:98%Color and Shape: white to off-white solidMolecular weight:161.95g/mol1H-Indazole-5-boronic acid
CAS:Formula:C7H7BN2O2Purity:97.0%Color and Shape:SolidMolecular weight:161.961H-Indazole-5-boronic acid
CAS:1H-Indazole-5-boronic acid is a potent compound that belongs to the class of indazole compounds. It has been shown to inhibit protein phosphorylation and induce morphological changes in cells. This compound also inhibits the activity of a number of different cellular enzymes, including protein phosphatases, protein kinases, and protein tyrosine phosphatases. 1H-Indazole-5-boronic acid has been shown to be a promising lead compound for the discovery of novel inhibitors of these enzymes.Formula:C7H7BN2O2Purity:Min. 95%Molecular weight:161.95 g/mol



