CAS 338454-14-1

1H-indazol-5-ylboronic acid

Description:

1H-Indazol-5-ylboronic acid is an organic compound characterized by the presence of both an indazole ring and a boronic acid functional group. The indazole moiety contributes to its aromaticity and potential for various chemical reactions, while the boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. This compound typically exhibits good solubility in polar solvents, which enhances its reactivity in coupling reactions, such as Suzuki-Miyaura cross-coupling, a widely used method for forming carbon-carbon bonds. Additionally, the presence of the boronic acid group allows for potential applications in drug development, particularly in the design of inhibitors targeting specific biological pathways. The compound's molecular structure and properties make it a valuable building block in organic synthesis and a subject of interest in research focused on developing new therapeutic agents.

Formula: C₇H₇BN₂O₂

InChI: InChI=1/C7H7BN2O2/c11-8(12)6-1-2-7-5(3-6)4-9-10-7/h1-4,11-12H,(H,9,10)

SMILES: c1cc2c(cc1B(O)O)cn[nH]2

Synonyms:

• Boronic acid, B-1H-indazol-5-yl-
• 1H-Indazole-5-boronicacid
• 1H-Indazole-5-Boronic Acid
• (1H-indazol-5-yl)boronic acid

1H-Indazole-5-boronic acid

CAS: 338454-14-1

Formula: C₇H₇BN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.9537

Ref: IN-DA0038TM

1H-Indazole-5-boronic acid

CAS: 338454-14-1

1H-Indazole-5-boronic acid

Formula: C₇H₇BN₂O₂

Purity: 98%

Color and Shape: white to off-white solid

Molecular weight: 161.95g/mol

Ref: 54-OR60111

Indazole-5-boronic acid

CAS: 338454-14-1

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.9600067

Ref: 10-F788299

1H-Indazole-5-boronic acid

CAS: 338454-14-1

Formula: C₇H₇BN₂O₂

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 161.96

Ref: 10-F046157

1H-Indazole-5-boronic acid

CAS: 338454-14-1

1H-Indazole-5-boronic acid is a potent compound that belongs to the class of indazole compounds. It has been shown to inhibit protein phosphorylation and induce morphological changes in cells. This compound also inhibits the activity of a number of different cellular enzymes, including protein phosphatases, protein kinases, and protein tyrosine phosphatases. 1H-Indazole-5-boronic acid has been shown to be a promising lead compound for the discovery of novel inhibitors of these enzymes.

Formula: C₇H₇BN₂O₂

Purity: Min. 95%

Molecular weight: 161.95 g/mol

Ref: 3D-FI29055