CAS 338454-30-1
:4-Benzyloxy-3-methylphenylboronic acid
Description:
4-Benzyloxy-3-methylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with a benzyloxy group and a methyl group, contributing to its unique chemical properties. The boronic acid moiety allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of the benzyloxy group enhances the compound's solubility and stability in organic solvents. The compound's structure suggests potential applications in drug development and materials science, particularly in the design of sensors or catalysts. Its reactivity and functional versatility make it a valuable building block in the synthesis of more complex organic molecules. As with many boronic acids, care should be taken in handling due to potential reactivity with moisture and sensitivity to air.
Formula:C14H15BO3
InChI:InChI=1/C14H15BO3/c1-11-9-13(15(16)17)7-8-14(11)18-10-12-5-3-2-4-6-12/h2-9,16-17H,10H2,1H3
SMILES:Cc1cc(ccc1OCc1ccccc1)B(O)O
Synonyms:- (4-Benzyloxy-3-methylphenyl)boronic acid
- 4-Benzyloxy-3-methylbenzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Benzyloxy-3-methylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C14H15BO3Purity:96.0 to 108.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:242.084-Benzyloxy-3-methylbenzeneboronic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C14H15BO3Purity:96%Molecular weight:242.08(4-(Benzyloxy)-3-methylphenyl)boronic acid
CAS:Formula:C14H15BO3Purity:97%Color and Shape:SolidMolecular weight:242.07814-Benzyloxy-3-methylbenzeneboronic acid
CAS:<p>4-Benzyloxy-3-methylbenzeneboronic acid</p>Formula:C14H15BO3Purity:98%Color and Shape: white solidMolecular weight:242.08g/mol(4-(Benzyloxy)-3-methylphenyl)boronic acid
CAS:Formula:C14H15BO3Purity:98%Color and Shape:SolidMolecular weight:242.08





