CAS 33860-28-5
:4-carbamothioyl-1-methylpiperazin-1-ium
Description:
4-Carbamothioyl-1-methylpiperazin-1-ium, identified by its CAS number 33860-28-5, is a chemical compound that features a piperazine ring substituted with a carbamothioyl group and a methyl group. This compound is characterized by its quaternary ammonium structure, which contributes to its ionic nature. The presence of the carbamothioyl moiety indicates that it contains a carbonyl group bonded to a thiol, which can influence its reactivity and potential applications in various chemical processes. The piperazine ring provides a cyclic structure that can enhance the compound's stability and solubility in polar solvents. Additionally, the methyl group attached to the nitrogen atom of the piperazine ring can affect the compound's steric properties and overall biological activity. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation and characterization through experimental studies.
Formula:C6H14N3S
InChI:InChI=1/C6H13N3S/c1-8-2-4-9(5-3-8)6(7)10/h2-5H2,1H3,(H2,7,10)/p+1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Methyl-1-piperazinecarbothioamide
CAS:4-Methyl-1-piperazinecarbothioamide is a prophylactic agent that has been shown to be effective in preventing the development of hemorrhagic fever caused by arenaviruses. It is also used as an experimental antiviral drug for the treatment of viral infections. 4-Methyl-1-piperazinecarbothioamide inhibits the activity of viral enzymes, such as RNA polymerase, and prevents the synthesis of viral proteins. This compound has been shown to be effective against many different types of viruses, including hemorrhagic fever viruses and influenza A virus. This drug is an analog of amide derivatives that have been shown to inhibit fever, infections, and amide derivatives.Formula:C6H13N3SPurity:Min. 95%Molecular weight:159.26 g/mol

