CAS 3387-26-6

3,4-Furandicarboxylic acid

Description:

3,4-Furandicarboxylic acid (FDCA) is an organic compound characterized by its furan ring structure with two carboxylic acid groups located at the 3 and 4 positions. It is a white crystalline solid that is soluble in water and various organic solvents. FDCA is notable for its potential as a renewable building block in the production of bioplastics, particularly polyethylene furanoate (PEF), which serves as an alternative to petroleum-based plastics. The compound exhibits good thermal stability and has a melting point that allows for processing in various applications. Additionally, FDCA is recognized for its biodegradable properties, making it an attractive option in the context of sustainable materials. Its synthesis can be achieved through the oxidation of sugars or other biomass-derived materials, aligning with green chemistry principles. Overall, 3,4-furandicarboxylic acid represents a significant advancement in the development of eco-friendly materials and contributes to the ongoing efforts to reduce reliance on fossil fuels in the chemical industry.

Formula: C₆H₄O₅

InChI: InChI=1S/C6H4O5/c7-5(8)3-1-11-2-4(3)6(9)10/h1-2H,(H,7,8)(H,9,10)

InChI key: InChIKey=SYLAFCZSYRXBJF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C(O)=O)=COC1

Synonyms:

• NSC 629037
• NSC 191922
• 3,4-Furandicarboxylic acid

FURAN-3,4-DICARBOXYLIC ACID

CAS: 3387-26-6

Formula: C₆H₄O₅

Purity: 96%

Color and Shape: Solid

Molecular weight: 156.0930

Ref: IN-DA003IJ8

Furan-3,4-dicarboxylic acid

CAS: 3387-26-6

Furan-3,4-dicarboxylic acid

Purity: 97%

Molecular weight: 156.09g/mol

Ref: 54-OR76908

Furan-3,4-dicarboxylic acid

CAS: 3387-26-6

Formula: C₆H₄O₅

Purity: 96%

Color and Shape: Solid

Molecular weight: 156.093

Ref: 10-F446688

3,4-Furandicarboxylic acid

CAS: 3387-26-6

3,4-Furandicarboxylic acid is a crystalline compound that belongs to the group of carboxylic acids. It is formed by the hydrogenation of 3,4-dihydroxyphenylacetic acid and has been used in the industrial production of diethyl esters. The crystal structure of 3,4-furandicarboxylic acid has been determined using X-ray crystallography. This compound forms a dihedral angle with the ethyl group and hydrogen bonds to the proton on one side and an intramolecular hydrogen bond on the other side. 3,4-Furandicarboxylic acid is used as a precursor for hydrochloric acid and as an energy-efficient fuel in organic synthesis reactions.

Formula: C₆H₄O₅

Purity: Min. 95%

Molecular weight: 156.09 g/mol

Ref: 3D-DAA38726