CAS 33873-09-5

2,6-difluoropyrazine

Description:

2,6-Difluoropyrazine is a heterocyclic organic compound characterized by a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. The presence of fluorine substituents at the 2 and 6 positions enhances its chemical reactivity and influences its physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its moderate polarity and can engage in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. 2,6-Difluoropyrazine is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as a building block in organic synthesis. Additionally, its fluorine atoms can impart unique electronic properties, making it valuable in medicinal chemistry. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health risks if inhaled or ingested.

Formula: C₄H₂F₂N₂

InChI: InChI=1/C4H2F2N2/c5-3-1-7-2-4(6)8-3/h1-2H

SMILES: c1c(F)nc(cn1)F

Synonyms:

• Pyrazine, 2,6-difluoro-

2,6-Difluoropyrazine

CAS: 33873-09-5

Formula: C₄H₂F₂N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 116.0689

Ref: IN-DA00CUFT

2,6-Difluoropyrazine

CAS: 33873-09-5

2,6-Difluoropyrazine

Purity: 98%

Ref: 54-PC1001987

2,6-Difluoropyrazine

CAS: 33873-09-5

Purity: 98%

Molecular weight: 116.0709991

Ref: 10-F639628

2,6-Difluoropyrazine

Controlled Product

CAS: 33873-09-5

Formula: C₄H₂F₂N₂

Color and Shape: Neat

Molecular weight: 116.069

Ref: TR-D455938