CAS 338755-71-8
:2′-(4-Chlorophenyl)spiro[2H-1-benzothiopyran-3(4H),5′-[1,3]dioxan]-4-one
Description:
2′-(4-Chlorophenyl)spiro[2H-1-benzothiopyran-3(4H),5′-[1,3]dioxan]-4-one is a synthetic organic compound characterized by its complex molecular structure, which includes a spiro linkage between a benzothiopyran and a dioxan moiety. The presence of a 4-chlorophenyl group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound may exhibit various functional properties due to the presence of multiple heteroatoms and aromatic systems, which can affect its solubility, stability, and interaction with biological targets. The spiro structure often imparts rigidity to the molecule, which can be advantageous in drug design, as it may enhance binding affinity to specific receptors. Additionally, the compound's potential applications could span across medicinal chemistry, particularly in the development of pharmaceuticals, given its structural features that may be relevant for therapeutic activity. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C18H15ClO3S
InChI:InChI=1S/C18H15ClO3S/c19-13-7-5-12(6-8-13)17-21-9-18(10-22-17)11-23-15-4-2-1-3-14(15)16(18)20/h1-8,17H,9-11H2
InChI key:InChIKey=YXIFWZVJXKYRBE-UHFFFAOYSA-N
SMILES:O=C1C2(CSC=3C1=CC=CC3)COC(OC2)C4=CC=C(Cl)C=C4
Synonyms:- 2′-(4-Chlorophenyl)spiro[2H-1-benzothiopyran-3(4H),5′-[1,3]dioxan]-4-one
- Spiro[2H-1-benzothiopyran-3(4H),5′-[1,3]dioxan]-4-one, 2′-(4-chlorophenyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery