CymitQuimica logo

CAS 338756-50-6

:

N,N-Dimethyl-N′-[[[(4-methylphenyl)methoxy]amino]carbonyl]methanimidamide

Description:
N,N-Dimethyl-N′-[[[(4-methylphenyl)methoxy]amino]carbonyl]methanimidamide, identified by its CAS number 338756-50-6, is a synthetic organic compound characterized by its complex structure, which includes a dimethylamino group, a methoxy group, and an aromatic ring. This compound typically exhibits properties associated with amides and imidamides, such as potential solubility in polar solvents due to the presence of polar functional groups. The presence of the 4-methylphenyl moiety suggests that it may exhibit hydrophobic characteristics, influencing its overall solubility and reactivity. Additionally, the compound may participate in hydrogen bonding due to the amide functionality, which can affect its biological activity and interactions with other molecules. Its specific applications and biological properties would depend on further studies, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C12H17N3O2
InChI:InChI=1S/C12H17N3O2/c1-10-4-6-11(7-5-10)8-17-14-12(16)13-9-15(2)3/h4-7,9H,8H2,1-3H3,(H,14,16)
InChI key:InChIKey=YUTAHEQKSQBAIN-UHFFFAOYSA-N
SMILES:C(ONC(N=CN(C)C)=O)C1=CC=C(C)C=C1
Synonyms:
  • Urea, [(dimethylamino)methylene][(4-methylphenyl)methoxy]-
  • N,N-Dimethyl-N′-[[[(4-methylphenyl)methoxy]amino]carbonyl]methanimidamide
  • Methanimidamide, N,N-dimethyl-N′-[[[(4-methylphenyl)methoxy]amino]carbonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.