CAS 33878-50-1: N-Benzoyl-N-(3,4-dichlorophenyl)-L-alanine ethyl ester

Description:N-Benzoyl-N-(3,4-dichlorophenyl)-L-alanine ethyl ester, with CAS number 33878-50-1, is a chemical compound that belongs to the class of amino acid derivatives. This substance features a benzoyl group and a dichlorophenyl moiety attached to the amino acid L-alanine, which is further esterified with ethyl alcohol. The presence of the dichlorophenyl group imparts specific electronic and steric properties, potentially influencing its biological activity and reactivity. The compound is typically characterized by its molecular structure, which includes functional groups such as an amide and an ester, contributing to its solubility and stability in various solvents. It may exhibit properties such as moderate to high lipophilicity due to the aromatic rings, which can affect its interaction with biological systems. Additionally, the compound may be of interest in pharmaceutical research, particularly in the development of drugs or as a biochemical tool, owing to its structural features that can modulate biological pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula:C₁₈H₁₇Cl₂NO₃

InChI:InChI=1S/C18H17Cl2NO3/c1-3-24-18(23)12(2)21(14-9-10-15(19)16(20)11-14)17(22)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3/t12-/m0/s1

InChI key:InChIKey=SLCGUGMPSUYJAY-LBPRGKRZSA-N

SMILES:O=C(OCC)C(N(C(=O)C=1C=CC=CC1)C2=CC=C(Cl)C(Cl)=C2)C