
CAS 338794-54-0
:4-Bromo-N-[[4-ethyl-5-[(2-phenoxyethyl)thio]-4H-1,2,4-triazol-3-yl]methyl]benzenesulfonamide
Description:
4-Bromo-N-[[4-ethyl-5-[(2-phenoxyethyl)thio]-4H-1,2,4-triazol-3-yl]methyl]benzenesulfonamide, with CAS number 338794-54-0, is a chemical compound characterized by its complex structure, which includes a sulfonamide group, a triazole ring, and a phenoxyethyl thioether moiety. This compound exhibits properties typical of sulfonamides, such as potential antibacterial activity, and is often studied for its pharmacological applications. The presence of the triazole ring suggests possible antifungal properties, as triazoles are known for their efficacy against various fungal infections. The bromine substituent may influence the compound's reactivity and biological activity, while the ethyl and phenoxy groups can enhance lipophilicity, potentially affecting its absorption and distribution in biological systems. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. Further studies would be necessary to fully elucidate its biological activity and mechanism of action.
Formula:C19H21BrN4O3S2
InChI:InChI=1S/C19H21BrN4O3S2/c1-2-24-18(14-21-29(25,26)17-10-8-15(20)9-11-17)22-23-19(24)28-13-12-27-16-6-4-3-5-7-16/h3-11,21H,2,12-14H2,1H3
InChI key:InChIKey=QKSUZNLJVQLYHF-UHFFFAOYSA-N
SMILES:C(NS(=O)(=O)C1=CC=C(Br)C=C1)C=2N(CC)C(SCCOC3=CC=CC=C3)=NN2
Synonyms:- Benzenesulfonamide, 4-bromo-N-[[4-ethyl-5-[(2-phenoxyethyl)thio]-4H-1,2,4-triazol-3-yl]methyl]-
- 4-Bromo-N-[[4-ethyl-5-[(2-phenoxyethyl)thio]-4H-1,2,4-triazol-3-yl]methyl]benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.