CAS 338794-93-7
:4-(3-Chlorophenyl)-β-imino-1-piperazinepropanenitrile
Description:
4-(3-Chlorophenyl)-β-imino-1-piperazinepropanenitrile, with the CAS number 338794-93-7, is a chemical compound characterized by its unique structural features, including a piperazine ring and a nitrile functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the chlorophenyl group and the piperazine moiety. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of the piperazine structure, which is common in many biologically active compounds. The nitrile group may contribute to its reactivity and solubility characteristics, influencing its interactions in biological systems. Additionally, the chlorophenyl substituent can affect the compound's electronic properties and lipophilicity, which are important for its pharmacokinetic profile. Overall, this compound's specific characteristics, including its stability, solubility, and reactivity, would be essential for understanding its potential applications in various fields, including drug development and chemical synthesis.
Formula:C13H15ClN4
InChI:InChI=1S/C13H15ClN4/c14-11-2-1-3-12(10-11)17-6-8-18(9-7-17)13(16)4-5-15/h1-3,10,16H,4,6-9H2
InChI key:InChIKey=UUXVGGNMQLFUBZ-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1)N2CCN(C(CC#N)=N)CC2
Synonyms:- 1-Piperazinepropanenitrile, 4-(3-chlorophenyl)-β-imino-
- Piperazine, 1-(3-chlorophenyl)-4-(2-cyano-1-iminoethyl)-
- 4-(3-Chlorophenyl)-β-imino-1-piperazinepropanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[4-(3-Chlorophenyl)piperazin-1-yl]-3-iminopropanenitrile
CAS:3-[4-(3-Chlorophenyl)piperazin-1-yl]-3-iminopropanenitrilePurity:techMolecular weight:262.74g/mol
