CAS 33889-70-2

4-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]naphtho[2,3-b]furan-7(8H)-one

Description:

The chemical substance known as 4-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]naphtho[2,3-b]furan-7(8H)-one, with the CAS number 33889-70-2, is a complex organic compound characterized by its naphthoquinone structure, which is a fused bicyclic system containing both naphthalene and a furan moiety. This compound features a hydroxyl group and an allylic ether, contributing to its reactivity and potential biological activity. It is typically recognized for its role in various chemical reactions, including those involving radical mechanisms and potential applications in medicinal chemistry due to its structural motifs that may exhibit antioxidant or anti-inflammatory properties. The presence of the hydroxy and alkene functionalities suggests that it may participate in hydrogen bonding and undergo various transformations, making it of interest in synthetic organic chemistry. Additionally, its unique structure may influence its solubility, stability, and interaction with biological systems, warranting further investigation into its properties and potential uses.

Formula: C₁₇H₁₆O₄

InChI: InChI=1/C17H16O4/c1-10(2)15(19)9-21-17-13-4-3-12(18)7-11(13)8-16-14(17)5-6-20-16/h3-6,8,15,19H,1,7,9H2,2H3

SMILES: C=C(C)C(COc1c2C=CC(=O)Cc2cc2c1cco2)O

Pabulenol

CAS: 33889-70-2

Pabulenol is an innovative biopolymer, which is synthesized from renewable plant-based resources through advanced biotechnological methods involving enzymatic polymerization. With its unique molecular structure, Pabulenol exhibits specific mode of action by facilitating biodegradation under ambient conditions, catalyzed by naturally occurring microbes. The polymer’s intrinsic ability to break down into non-toxic byproducts makes it an exceptional choice for sustainable environmental applications.

Purity: Min. 95%

Ref: 3D-FP74047