CAS 33889-70-2: 4-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]naphtho[2,3-b]furan-7(8H)-one

Description:The chemical substance known as 4-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]naphtho[2,3-b]furan-7(8H)-one, with the CAS number 33889-70-2, is a complex organic compound characterized by its naphthoquinone structure, which is a fused bicyclic system containing both naphthalene and a furan moiety. This compound features a hydroxyl group and an allylic ether, contributing to its reactivity and potential biological activity. It is typically recognized for its role in various chemical reactions, including those involving radical mechanisms and potential applications in medicinal chemistry due to its structural motifs that may exhibit antioxidant or anti-inflammatory properties. The presence of the hydroxy and alkene functionalities suggests that it may participate in hydrogen bonding and undergo various transformations, making it of interest in synthetic organic chemistry. Additionally, its unique structure may influence its solubility, stability, and interaction with biological systems, warranting further investigation into its properties and potential uses.

Formula:C₁₇H₁₆O₄

InChI:InChI=1/C17H16O4/c1-10(2)15(19)9-21-17-13-4-3-12(18)7-11(13)8-16-14(17)5-6-20-16/h3-6,8,15,19H,1,7,9H2,2H3