CAS 338953-29-0

[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thienylmethanone

Description:

[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thienylmethanone, with the CAS number 338953-29-0, is a synthetic organic compound characterized by its unique structural features. It contains a pyridine ring substituted with a chlorine atom and a trifluoromethyl group, which enhances its lipophilicity and potential biological activity. The thienyl group attached to the carbonyl moiety contributes to its reactivity and may influence its interaction with biological targets. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to modulate biological pathways. Its molecular structure suggests it may exhibit interesting electronic properties and could participate in various chemical reactions, including nucleophilic attacks and electrophilic substitutions. The presence of the trifluoromethyl group often imparts unique characteristics, such as increased metabolic stability and altered pharmacokinetics. Overall, this compound represents a valuable scaffold for further research in drug discovery and development.

Formula: C₁₁H₅ClF₃NOS

InChI: InChI=1S/C11H5ClF3NOS/c12-7-4-6(11(13,14)15)5-16-9(7)10(17)8-2-1-3-18-8/h1-5H

InChI key: InChIKey=UICDSCVETMBMCE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(C(F)(F)F)C=N1)C2=CC=CS2

Synonyms:

• [3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thienylmethanone
• Methanone, [3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thienyl-