
CAS 338954-52-2
:2-[[(3,4-Dichlorophenyl)methyl]thio]-5-methoxy-N-methyl-4-pyrimidinamine
Description:
2-[[(3,4-Dichlorophenyl)methyl]thio]-5-methoxy-N-methyl-4-pyrimidinamine, with CAS number 338954-52-2, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with various functional groups. The presence of a methoxy group and a methylthio group contributes to its unique reactivity and solubility properties. The dichlorophenyl moiety enhances its biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. This compound may exhibit specific interactions with biological targets due to its structural features, which can influence its pharmacokinetics and pharmacodynamics. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR, mass spectrometry, and chromatography to confirm its identity and purity. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C13H13Cl2N3OS
InChI:InChI=1S/C13H13Cl2N3OS/c1-16-12-11(19-2)6-17-13(18-12)20-7-8-3-4-9(14)10(15)5-8/h3-6H,7H2,1-2H3,(H,16,17,18)
InChI key:InChIKey=HGYVJDGUSWUBIY-UHFFFAOYSA-N
SMILES:S(CC1=CC(Cl)=C(Cl)C=C1)C=2N=C(NC)C(OC)=CN2
Synonyms:- 2-[[(3,4-Dichlorophenyl)methyl]thio]-5-methoxy-N-methyl-4-pyrimidinamine
- 4-Pyrimidinamine, 2-[[(3,4-dichlorophenyl)methyl]thio]-5-methoxy-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.