CAS 338959-90-3
:4-[(2-Cyanoethenyl)amino]benzonitrile
Description:
4-[(2-Cyanoethenyl)amino]benzonitrile, with the CAS number 338959-90-3, is an organic compound characterized by its aromatic structure and the presence of both cyano and amino functional groups. This compound features a benzene ring substituted with a cyano group and an amino group linked to a vinyl chain, which contributes to its reactivity and potential applications in organic synthesis and materials science. The cyano group imparts polarity and can participate in various chemical reactions, while the amino group can act as a nucleophile or a site for further functionalization. The compound's properties, such as solubility, melting point, and stability, can be influenced by the presence of these functional groups. Additionally, its structural features may allow it to exhibit interesting electronic properties, making it a candidate for use in electronic materials or as a building block in the synthesis of more complex molecules. Overall, 4-[(2-Cyanoethenyl)amino]benzonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H7N3
InChI:InChI=1S/C10H7N3/c11-6-1-7-13-10-4-2-9(8-12)3-5-10/h1-5,7,13H
InChI key:InChIKey=ZZWRGCTZIYLDIZ-UHFFFAOYSA-N
SMILES:N(C=CC#N)C1=CC=C(C#N)C=C1
Synonyms:- 4-[(2-Cyanoethenyl)amino]benzonitrile
- Benzonitrile, 4-[(2-cyanoethenyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-{[(1E)-2-Cyanoeth-1-en-1-yl]amino}benzonitrile
CAS:4-{[(1E)-2-Cyanoeth-1-en-1-yl]amino}benzonitrilePurity:techMolecular weight:169.18g/mol
