CymitQuimica logo

CAS 338962-12-2

:

Benzaldehyde, 2-[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]hydrazone

Description:
Benzaldehyde, 2-[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]hydrazone is a chemical compound characterized by its hydrazone functional group, which is formed from the reaction of benzaldehyde with a hydrazine derivative. This compound features a naphthyridine moiety substituted with two trifluoromethyl groups, contributing to its unique electronic and steric properties. The presence of trifluoromethyl groups typically enhances lipophilicity and can influence the compound's biological activity. The naphthyridine structure is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to interact with biological targets. The compound may exhibit interesting optical and electronic properties, making it a candidate for various applications in materials science and medicinal chemistry. Its specific reactivity and stability can be influenced by the presence of the hydrazone linkage, which can participate in tautomeric equilibria and may be sensitive to pH and other environmental factors. Overall, this compound represents a complex structure with potential utility in diverse chemical and biological contexts.
Formula:C17H10F6N4
InChI:InChI=1S/C17H10F6N4/c18-16(19,20)12-8-13(17(21,22)23)25-15-11(12)6-7-14(26-15)27-24-9-10-4-2-1-3-5-10/h1-9H,(H,25,26,27)
InChI key:InChIKey=RYZSCNXGVLAKSA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(C(F)(F)F)C1)N=C(NN=CC3=CC=CC=C3)C=C2
Synonyms:
  • Benzaldehyde, 2-[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]hydrazone
  • Benzaldehyde, [5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]hydrazone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.