CAS 338976-44-6
:6-(Isopropylthio)imidazo[2,1-b]thiazole-5-carboxaldehyde
Description:
6-(Isopropylthio)imidazo[2,1-b]thiazole-5-carboxaldehyde is a heterocyclic organic compound characterized by its imidazole and thiazole rings, which contribute to its unique chemical properties. The presence of the isopropylthio group enhances its reactivity and solubility in organic solvents. This compound features a carboxaldehyde functional group, which is known for its reactivity in various chemical reactions, including condensation and oxidation. The structural arrangement of the imidazo and thiazole rings imparts specific electronic properties, making it potentially useful in medicinal chemistry and as a building block in the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, which is often explored in drug discovery and development. Its CAS number, 338976-44-6, allows for precise identification and retrieval of information regarding its properties, safety data, and applications in scientific literature. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry and pharmacology.
Formula:C9H10N2OS2
InChI:InChI=1/C9H10N2OS2/c1-6(2)14-8-7(5-12)11-3-4-13-9(11)10-8/h3-6H,1-2H3
SMILES:CC(C)Sc1c(C=O)n2ccsc2n1
Synonyms:- 6-(Isopropylsulfanyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde
- Imidazo[2,1-B]Thiazole-5-Carboxaldehyde, 6-[(1-Methylethyl)Thio]-
- 6-(Propan-2-Ylsulfanyl)Imidazo[2,1-B][1,3]Thiazole-5-Carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(Isopropylthio)imidazo[2,1-b]thiazole-5-carbaldehyde
CAS:Formula:C9H10N2OS2Molecular weight:226.3185
