CAS 339-44-6
:Benzenesulfonamide, N-[5-(2-methoxyethoxy)-2-pyrimidinyl]-
Description:
Benzenesulfonamide, N-[5-(2-methoxyethoxy)-2-pyrimidinyl]- is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a pyrimidine ring substituted with a 2-methoxyethoxy group, contributing to its solubility and potential biological activity. The presence of the benzenesulfonamide moiety suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure allows for hydrogen bonding and potential interactions with proteins, which can influence its pharmacological properties. Additionally, the methoxyethoxy group enhances its lipophilicity, potentially affecting its absorption and distribution in biological systems. Overall, this compound's unique structure and functional groups position it as a candidate for further research in drug development and therapeutic applications.
Formula:C13H15N3O4S
InChI:InChI=1/C13H15N3O4S/c1-19-7-8-20-11-9-14-13(15-10-11)16-21(17,18)12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3,(H,14,15,16)
InChI key:InChIKey=QFWPJPIVLCBXFJ-UHFFFAOYSA-N
SMILES:S(NC=1N=CC(OCCOC)=CN1)(=O)(=O)C2=CC=CC=C2
Synonyms:- 2-Benzenesulfonamido-5-(2-methoxyethoxy)pyrimidine
- Glidiazine
- Glymidine
- N-[5-(2-Methoxyethoxy)-2-pyrimidinyl]benzolsulfonamid
- N-[5-(2-methoxyethoxy)-2-pyrimidinyl]benzenesulfonamide
- N-[5-(2-methoxyethoxy)-2-pyrimidinyl]benzenesulphonamide
- N-[5-(2-metoxietoxi)-2-pirimidinil]bencenosulfonamida
- Glycodiazin
- Benzenesulfonamide, N-[5-(2-methoxyethoxy)-2-pyrimidinyl]-
- 2-Benzolsulfonamido-5-beta-methoxy-aethoxy-pyrimidine
- BRN 0552655
- 5-beta-(Methoxyethoxy)-2-(phenylsulfonylamido)pyrimidine
- Benzenesulfonamide, N-(5-(2-methoxyethoxy)-2-pyrimidinyl)-
- Glymidinum
- UNII-4C5I4BQZ8F
- 5-25-12-00549 (Beilstein Handbook Reference)
- Glycodiazin [German]
- 2-Benzolsulfonamido-5-beta-methoxy-aethoxy-pyrimidine [German]
- Glycodiazine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Glymidine
CAS:Glycodiazine, a sulfadiazine derivative, reduces blood sugar by boosting insulin release and sensitivity.Formula:C13H15N3O4SColor and Shape:SolidMolecular weight:309.34Glymidine
CAS:Controlled ProductApplications Glymidine is used in biological activities to predict human intestinal absorption in drug discovery.
References Moda, T. L. et al.: Bioorg. Med. Chem. Lett., 22, 2889 (2012);Formula:C13H15N3O4SColor and Shape:NeatMolecular weight:309.34


