CAS 339008-33-2
:6-Chloro-^a-(3-methylphenyl)-3-pyridazineacetonitrile
Description:
6-Chloro-α-(3-methylphenyl)-3-pyridazineacetonitrile, with the CAS number 339008-33-2, is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chloro substituent at the 6-position and a 3-methylphenyl group at the α-position contributes to its unique chemical properties. This compound is typically classified as an organic nitrile due to the presence of the acetonitrile functional group, which features a cyano group (-C≡N) attached to a carbon atom. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyridazine ring is often associated with various biological activities. Additionally, the presence of halogen and aromatic groups may influence its reactivity and solubility in different solvents. Overall, 6-Chloro-α-(3-methylphenyl)-3-pyridazineacetonitrile is of interest for its potential utility in synthetic organic chemistry and drug development.
Formula:C13H10ClN3
InChI:InChI=1/C13H10ClN3/c1-9-3-2-4-10(7-9)11(8-15)12-5-6-13(14)17-16-12/h2-7,11H,1H3
SMILES:Cc1cccc(c1)C(C#N)c1ccc(Cl)nn1
Synonyms:- 3-Pyridazineacetonitrile, 6-Chloro-Alpha-(3-Methylphenyl)-
- (6-Chloropyridazin-3-Yl)(3-Methylphenyl)Acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
