CAS 339009-32-4

Ethyl 3-[(4-methylbenzoyl)amino]-2-oxo-6-phenyl-2H-pyran-5-carboxylate

Description:

Ethyl 3-[(4-methylbenzoyl)amino]-2-oxo-6-phenyl-2H-pyran-5-carboxylate, with CAS number 339009-32-4, is a synthetic organic compound characterized by its complex structure, which includes a pyran ring fused with various functional groups. This compound features an ethyl ester group, a carbonyl group, and an amide linkage, contributing to its potential reactivity and biological activity. The presence of the 4-methylbenzoyl moiety suggests that it may exhibit aromatic characteristics, which can influence its solubility and interaction with other molecules. The pyran ring structure is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Its potential applications could span from pharmaceuticals to agrochemicals, depending on its specific properties and biological interactions. Additionally, the compound's stability, solubility, and reactivity would be influenced by the substituents on the pyran ring and the ethyl ester, which are critical for determining its practical uses in research and industry.

Formula: C₂₂H₁₉NO₅

InChI: InChI=1S/C22H19NO5/c1-3-27-21(25)17-13-18(23-20(24)16-11-9-14(2)10-12-16)22(26)28-19(17)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3,(H,23,24)

InChI key: InChIKey=QTUICLYEVNXSIY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(OC(=O)C(NC(=O)C2=CC=C(C)C=C2)=C1)C3=CC=CC=C3

Synonyms:

• Ethyl 3-[(4-methylbenzoyl)amino]-2-oxo-6-phenyl-2H-pyran-5-carboxylate
• 2H-Pyran-5-carboxylic acid, 3-[(4-methylbenzoyl)amino]-2-oxo-6-phenyl-, ethyl ester