CymitQuimica logo

CAS 339015-93-9

:

1-(4-Acetylphenyl)-3,3-dimethyl-2-azetidinone

Description:
1-(4-Acetylphenyl)-3,3-dimethyl-2-azetidinone, identified by its CAS number 339015-93-9, is a chemical compound characterized by its azetidinone structure, which is a four-membered lactam. This compound features an acetylphenyl group, contributing to its aromatic characteristics, and two methyl groups attached to the azetidinone ring, which can influence its steric and electronic properties. The presence of the acetyl group suggests potential reactivity in nucleophilic substitution or condensation reactions. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its solubility and stability in different solvents. Additionally, the azetidinone ring may impart unique properties related to ring strain and reactivity, potentially leading to applications in drug development or as a synthetic intermediate in organic chemistry. Overall, this compound represents a unique combination of structural features that may be explored for various chemical and biological applications.
Formula:C13H15NO2
InChI:InChI=1S/C13H15NO2/c1-9(15)10-4-6-11(7-5-10)14-8-13(2,3)12(14)16/h4-7H,8H2,1-3H3
InChI key:InChIKey=AJNXSXRDNTYTEW-UHFFFAOYSA-N
SMILES:O=C1N(CC1(C)C)C2=CC=C(C(C)=O)C=C2
Synonyms:
  • 2-Azetidinone, 1-(4-acetylphenyl)-3,3-dimethyl-
  • 1-(4-Acetylphenyl)-3,3-dimethyl-2-azetidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.