CAS 339029-59-3

3-Chloro-1′,6′-dihydro-6′-oxo-5-(trifluoromethyl)[2,3′-bipyridine]-5′-carbonitrile

Description:

3-Chloro-1′,6′-dihydro-6′-oxo-5-(trifluoromethyl)[2,3′-bipyridine]-5′-carbonitrile is a chemical compound characterized by its complex structure, which includes a bipyridine framework and multiple functional groups. The presence of a chloro group and a trifluoromethyl group contributes to its unique reactivity and potential applications in various chemical reactions. The carbonitrile functional group enhances its polarity and can influence its solubility in different solvents. This compound is likely to exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Additionally, the presence of the oxo group may impart specific chemical properties, such as the ability to participate in hydrogen bonding or act as a reactive electrophile. Overall, this compound's distinctive features make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₂H₅ClF₃N₃O

InChI: InChI=1S/C12H5ClF3N3O/c13-9-2-8(12(14,15)16)5-18-10(9)7-1-6(3-17)11(20)19-4-7/h1-2,4-5H,(H,19,20)

InChI key: InChIKey=ZGVGCFYLRVIOOS-UHFFFAOYSA-N

SMILES: ClC1=C(N=CC(C(F)(F)F)=C1)C=2C=C(C#N)C(=O)NC2

Synonyms:

• 3-Chloro-1′,6′-dihydro-6′-oxo-5-(trifluoromethyl)[2,3′-bipyridine]-5′-carbonitrile
• [2,3′-Bipyridine]-5′-carbonitrile, 3-chloro-1′,6′-dihydro-6′-oxo-5-(trifluoromethyl)-

3-Cyano-5-(3-chloro-5-trifluoromethyl-2-pyridyl)-2-hydroxypyridine

CAS: 339029-59-3

3-Cyano-5-(3-chloro-5-trifluoromethyl-2-pyridyl)-2-hydroxypyridine

Purity: 95%

Molecular weight: 299.64g/mol

Ref: 54-PC109339