CAS 339068-25-6

N'-(4-butyl-2-methylphenyl)-N-hydroxyimidoformamide

Description:

N'-(4-butyl-2-methylphenyl)-N-hydroxyimidoformamide, identified by its CAS number 339068-25-6, is a chemical compound characterized by its imidoformamide structure, which features a hydroxyimido functional group. This compound typically exhibits properties associated with both amides and hydroxyl groups, potentially influencing its solubility and reactivity. The presence of the butyl and methyl substituents on the aromatic ring suggests that it may have hydrophobic characteristics, which could affect its interactions in biological systems or its solubility in organic solvents. Additionally, the hydroxyimido group may impart specific reactivity, making it useful in various chemical applications, including as a ligand in coordination chemistry or as a precursor in organic synthesis. The compound's stability, melting point, boiling point, and specific reactivity would depend on its molecular interactions and the environment in which it is used. Overall, this compound's unique structure and substituents contribute to its potential utility in various chemical and industrial applications.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1/C12H18N2O/c1-3-4-5-11-6-7-12(10(2)8-11)13-9-14-15/h6-9,15H,3-5H2,1-2H3,(H,13,14)

SMILES: CCCCc1ccc(c(C)c1)N=CNO

Synonyms:

• methanimidamide, N'-(4-butyl-2-methylphenyl)-N-hydroxy-
• N-(4-butyl-2-methylphenyl)-N'-hydroxyiminoformamide

N'-(4-Butyl-2-methylphenyl)-N-hydroxyformimidamide

CAS: 339068-25-6

N'-(4-Butyl-2-methylphenyl)-N-hydroxyformimidamide

Purity: 98%

Molecular weight: 206.29g/mol

Ref: 54-OR1073878

HET0016

CAS: 339068-25-6

HET0016: potent, selective 20-HETE synthase/CYP450 inhibitor; IC50s: 17.7-20.6 nM; inhibits angiogenesis, tumor growth.

Formula: C₁₂H₁₈N₂O

Purity: 98.84%

Color and Shape: Solid

Molecular weight: 206.28

Ref: TM-T11556