![Methanimidamide, N-[3-chloro-4-(4-morpholinyl)phenyl]-N'-hydroxy-](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F369462-methanimidamide-n-3-chloro-4-4-morpholinyl-phenyl-n-hydroxy.webp&w=3840&q=75)
CAS 339071-18-0
:Methanimidamide, N-[3-chloro-4-(4-morpholinyl)phenyl]-N'-hydroxy-
Description:
Methanimidamide, N-[3-chloro-4-(4-morpholinyl)phenyl]-N'-hydroxy- is a chemical compound characterized by its unique structure, which includes a methanimidamide functional group and a hydroxyl group attached to a phenyl ring substituted with a chlorine atom and a morpholine moiety. This compound is typically classified as an organic amide and may exhibit properties such as solubility in polar solvents, potential biological activity, and the ability to form hydrogen bonds due to the presence of the hydroxyl group. The morpholine ring contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. The chlorine substitution on the phenyl ring can influence the compound's reactivity and interaction with biological targets. Overall, this compound's specific characteristics, including its stability, reactivity, and biological activity, would depend on its molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C11H14ClN3O2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(E)-N-(3-chloro-4-Morpholinophenyl)-N'-hydroxyforMiMidaMide
CAS:Formula:C11H14ClN3O2Purity:99.08%Color and Shape:SolidMolecular weight:255.7008N-(3-Chloro-4-Morpholinophenyl)-N'-Hydroxyformimidamide
CAS:N-(3-Chloro-4-Morpholinophenyl)-N'-HydroxyformimidamidePurity:97%Molecular weight:255.7g/molTS-011
CAS:<p>N-(3-Chloro-4-morpholinophenyl)-N'-hydroxyformimidamide (TS-011) is a selective 20-Hydroxyeicosatetraenoic acid synthesis inhibitor.</p>Formula:C11H14ClN3O2Purity:99.48%Color and Shape:SolidMolecular weight:255.7
